CymitQuimica logo

CAS 105807-83-8

:

6-amino-2,2-dimethyl-2H-1,4-benzoxazin-3(4H)-one

Description:
6-Amino-2,2-dimethyl-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 105807-83-8, is a chemical compound characterized by its unique benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of an amino group contributes to its reactivity, allowing for potential interactions in biological systems. Its dimethyl substitution enhances its lipophilicity, which may influence its bioavailability and solubility in organic solvents. The compound's structural features suggest it may possess interesting biological activities, making it a subject of research in medicinal chemistry. Additionally, its stability under standard conditions and the ability to undergo various chemical transformations are important characteristics that can be exploited in synthetic applications. Overall, 6-amino-2,2-dimethyl-2H-1,4-benzoxazin-3(4H)-one represents a versatile compound with significant potential for further exploration in both academic and industrial settings.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-10(2)9(13)12-7-5-6(11)3-4-8(7)14-10/h3-5H,11H2,1-2H3,(H,12,13)
InChI key:UXMAGPQBCODAEJ-UHFFFAOYSA-N
SMILES:CC1(C)C(=Nc2cc(ccc2O1)N)O
Synonyms:
  • 2H-1,4-benzoxazin-3(4H)-one, 6-amino-2,2-dimethyl-
  • 7-amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one
  • 6-Amino-2,2-dimethyl-2H-1,4-benzoxazin-3(4H)-one
Found 4 products.