CymitQuimica logo

CAS 1058137-81-7

:

(1-(((Benzyloxy)carbonyl)amino)cyclopropyl)methyl methanesulfonate

Description:
(1-(((Benzyloxy)carbonyl)amino)cyclopropyl)methyl methanesulfonate, with CAS number 1058137-81-7, is a chemical compound characterized by its complex structure, which includes a cyclopropyl group, a benzyloxycarbonyl amino moiety, and a methanesulfonate functional group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential as a building block for more complex molecules. The presence of the methanesulfonate group suggests it may participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of pharmaceuticals. Additionally, the benzyloxycarbonyl group can provide protection for amine functionalities during synthetic processes. The cyclopropyl ring contributes to the compound's unique steric and electronic properties, which can influence its reactivity and interactions in biological systems. Overall, this compound's characteristics make it a valuable tool in chemical research and development, particularly in the fields of drug discovery and development.
Formula:C13H17NO5S
InChI:InChI=1S/C13H17NO5S/c1-20(16,17)19-10-13(7-8-13)14-12(15)18-9-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,14,15)
InChI key:TWUIVVKKBNGSPY-UHFFFAOYSA-N
SMILES:CS(=O)(=O)OCC1(CC1)NC(=O)OCC2=CC=CC=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.