CymitQuimica logo

CAS 105869-43-0

:

(2-cyclohexylethyl)boronic acid

Description:
(2-Cyclohexylethyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a cyclohexyl-substituted ethyl chain. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its boronic acid functionality allows it to participate in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the cyclohexyl group contributes to its steric properties, influencing its reactivity and interactions with other molecules. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. The compound's stability and reactivity can be affected by factors such as pH and the presence of other functional groups. Overall, (2-cyclohexylethyl)boronic acid is a versatile building block in synthetic chemistry, with potential applications in pharmaceuticals and materials science.
Formula:C8H17BO2
InChI:InChI=1/C8H17BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h8,10-11H,1-7H2
InChI key:UTDUYVCUESABMU-UHFFFAOYSA-N
SMILES:C1CCC(CC1)CCB(O)O
Found 5 products.