CymitQuimica logo

CAS 105890-71-9

:

Phosphonium, tributylhexyl-, bromide

Description:
Tributylhexylphosphonium bromide is a quaternary ammonium salt characterized by its phosphonium cation and bromide anion. It typically appears as a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. This compound is known for its high thermal stability and solubility in organic solvents, making it useful in various applications, including as a phase transfer catalyst and in ionic liquid formulations. Its structure features a central phosphorus atom bonded to three butyl groups and one hexyl group, contributing to its hydrophobic properties. The presence of the bromide ion enhances its ionic character, which can influence its reactivity and interaction with other chemical species. Additionally, tributylhexylphosphonium bromide may exhibit antimicrobial properties and is being explored for potential applications in materials science and electrochemistry. Safety considerations should be taken into account, as with many phosphonium compounds, due to potential toxicity and environmental impact.
Formula:C18H40P・Br
InChI:InChI=1S/C18H40P.BrH/c1-5-9-13-14-18-19(15-10-6-2,16-11-7-3)17-12-8-4;/h5-18H2,1-4H3;1H/q+1;/p-1
InChI key:ZBZFETNHIRABGK-UHFFFAOYSA-M
SMILES:CCCCCC[P+](CCCC)(CCCC)CCCC.[Br-]
Synonyms:
  • Tributylhexylphosphonium Bromide
Found 6 products.