CymitQuimica logo

CAS 105908-43-8

:

5-Chloro-2,4,8-trimethylquinoline

Description:
5-Chloro-2,4,8-trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine substituent at the 5-position and three methyl groups at the 2, 4, and 8 positions of the quinoline ring. Its molecular structure contributes to its unique chemical properties, including potential biological activity and applications in various fields such as pharmaceuticals and agrochemicals. The presence of the chlorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the trimethyl substitutions may affect the compound's solubility and stability. As with many quinoline derivatives, 5-Chloro-2,4,8-trimethylquinoline may exhibit fluorescence, making it useful in analytical chemistry and as a dye. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C12H12ClN
InChI:InChI=1/C12H12ClN/c1-7-4-5-10(13)11-8(2)6-9(3)14-12(7)11/h4-6H,1-3H3
SMILES:Cc1ccc(c2c(C)cc(C)nc12)Cl
Found 1 products.