CymitQuimica logo

CAS 105919-34-4

:

Cyclopropanecarboxylic acid, 2-fluoro-, cis-

Description:
Cyclopropanecarboxylic acid, 2-fluoro-, cis- is a chemical compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The "2-fluoro" designation signifies that a fluorine atom is attached to the second carbon of the cyclopropane ring, influencing the compound's reactivity and physical properties. The "cis" configuration indicates that the substituents (the carboxylic acid and the fluorine) are on the same side of the cyclopropane ring, which can affect the compound's stereochemistry and interactions with other molecules. This compound may exhibit unique properties such as increased acidity compared to its non-fluorinated counterparts, and its fluorine substitution can enhance lipophilicity and influence biological activity. Cyclopropanecarboxylic acid derivatives are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential applications in synthesis and as intermediates.
Formula:C4H5FO2
InChI:InChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3+/m1/s1
InChI key:HZQKMZGKYVDMCT-GBXIJSLDSA-N
SMILES:C1[C@H]([C@H]1F)C(=O)O
Synonyms:
  • (1S,2S)-2-fluorocyclopropanecarboxylic acid
Found 4 products.