CymitQuimica logo

CAS 105924-64-9

:

3,3,3-trifluoro-1-(phenylsulfonyl)-1-propene

Description:
3,3,3-Trifluoro-1-(phenylsulfonyl)-1-propene, with the CAS number 105924-64-9, is an organic compound characterized by the presence of a trifluoromethyl group and a phenylsulfonyl moiety. This compound features a propene backbone, which contributes to its reactivity and potential applications in organic synthesis. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and additions. The phenylsulfonyl group serves as a strong electron-withdrawing substituent, which can stabilize intermediates during chemical transformations. Additionally, the compound's structure suggests potential applications in pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their unique biological activities and improved metabolic stability. Its physical properties, such as boiling point and solubility, would be influenced by the presence of the fluorine atoms and the sulfonyl group, making it an interesting subject for further study in synthetic and medicinal chemistry.
Formula:C9H7F3O2S
InChI:InChI=1S/C9H7F3O2S/c10-9(11,12)6-7-15(13,14)8-4-2-1-3-5-8/h1-7H
InChI key:MXCAYGIFNXCLMK-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)C=CC(F)(F)F
Found 4 products.