CymitQuimica logo

CAS 105946-82-5

:

1,1'-Biphenyl, 4-bromo-4'-iodo-

Description:
1,1'-Biphenyl, 4-bromo-4'-iodo- is an organic compound characterized by the presence of two phenyl rings connected by a single bond, with bromine and iodine substituents located at the para positions of one of the phenyl rings. This compound is part of the biphenyl family and is notable for its halogenated structure, which can influence its reactivity and physical properties. Typically, such halogenated biphenyls exhibit unique electronic properties due to the presence of electronegative halogen atoms, which can affect their behavior in chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may also display interesting thermal and photophysical properties, making it of interest in various applications, including materials science and organic synthesis. Additionally, its molecular structure can lead to specific interactions in biological systems, warranting investigation into its potential environmental and health impacts. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental persistence.
Formula:C12H8BrI
InChI:InChI=1S/C12H8BrI/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H
InChI key:GWOAJJWBCSUGHH-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=CC=C(C=C2)I)Br
Synonyms:
  • 4-Iodo-4'-Bromobiphenyl
  • 4-BroMo-4'-iodobiphenyl
Found 6 products.