CymitQuimica logo

CAS 105972-24-5

:

2-[2-(4-Pyridinyl)ethyl]benzenamine

Description:
2-[2-(4-Pyridinyl)ethyl]benzenamine, also known by its CAS number 105972-24-5, is an organic compound characterized by its structure, which features a benzene ring substituted with an amino group and a 2-(4-pyridinyl)ethyl side chain. This compound typically exhibits properties associated with both aromatic amines and pyridine derivatives, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The pyridine moiety contributes to its basicity and can participate in hydrogen bonding, influencing its interactions in biological systems or chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its properties and effects. Safety and handling considerations are essential, as aromatic amines can pose health risks, necessitating appropriate precautions during use.
Formula:C13H14N2
InChI:InChI=1S/C13H14N2/c14-13-4-2-1-3-12(13)6-5-11-7-9-15-10-8-11/h1-4,7-10H,5-6,14H2
InChI key:InChIKey=ZGFRLWMJMWEDON-UHFFFAOYSA-N
SMILES:C(CC=1C=CN=CC1)C2=C(N)C=CC=C2
Synonyms:
  • 2-(2-Pyridin-4-Ylethyl)Aniline
  • 2-[2-(4-Pyridinyl)ethyl]benzenamine
  • 2-[2-(Pyridin-4-yl)ethyl]aniline
  • Benzenamine, 2-[2-(4-pyridinyl)ethyl]-
  • Pyridine, 4-(o-aminophenethyl)-
Found 2 products.