CymitQuimica logo

CAS 10601-73-7

:

Acetamide, N-(3-hydroxypropyl)-

Description:
Acetamide, N-(3-hydroxypropyl)-, also known by its CAS number 10601-73-7, is an organic compound characterized by the presence of an acetamide functional group attached to a 3-hydroxypropyl chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in water and various organic solvents, which enhances its utility in chemical applications. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. Acetamide derivatives are often studied for their roles in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound's properties, such as boiling point, melting point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c1-5(8)6-3-2-4-7/h7H,2-4H2,1H3,(H,6,8)
InChI key:LEICDYOVJNQLTN-UHFFFAOYSA-N
SMILES:CC(=O)NCCCO
Found 4 products.