CAS 106014-87-3
:3,3-Azetidinedicarboxylic acid, 1-(phenylmethyl)-
Description:
3,3-Azetidinedicarboxylic acid, 1-(phenylmethyl)-, also known by its CAS number 106014-87-3, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features two carboxylic acid functional groups attached to the azetidine ring, contributing to its acidity and potential reactivity. The presence of a phenylmethyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit interesting properties such as being a potential building block in organic synthesis or pharmaceutical applications. The azetidine ring can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, making it versatile in synthetic chemistry. Additionally, the compound's structural features may allow for interactions with biological targets, suggesting potential applications in medicinal chemistry. However, specific data regarding its solubility, melting point, and other physical properties would require further investigation or experimental determination.
Formula:C12H13NO4
InChI:InChI=1S/C12H13NO4/c14-10(15)12(11(16)17)7-13(8-12)6-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,15)(H,16,17)
InChI key:CWDWGQLVRSTJCN-UHFFFAOYSA-N
SMILES:C1C(CN1CC2=CC=CC=C2)(C(=O)O)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

