CymitQuimica logo

CAS 10602-00-3

:

4-Ethynylbenzoic acid

Description:
4-Ethynylbenzoic acid, with the CAS number 10602-00-3, is an organic compound characterized by the presence of both an ethynyl group and a carboxylic acid functional group attached to a benzene ring. This compound features a linear alkyne structure, which contributes to its unique reactivity and potential applications in organic synthesis. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the carboxylic acid group allows for hydrogen bonding, which can influence its physical properties and reactivity. 4-Ethynylbenzoic acid is often utilized in the synthesis of various organic materials, including polymers and pharmaceuticals, due to its ability to participate in coupling reactions. Additionally, it can serve as a building block in the development of functionalized materials for applications in fields such as materials science and medicinal chemistry.
Formula:C9H6O2
InChI:InChI=1/C9H6O2/c1-2-7-3-5-8(6-4-7)9(10)11/h1,3-6H,(H,10,11)
InChI key:SJXHLZCPDZPBPW-UHFFFAOYSA-N
SMILES:C#Cc1ccc(cc1)C(=O)O
Found 5 products.