CymitQuimica logo

CAS 10603-52-8

:

1-BENZYL-PYRROLIDINE-3-CARBONITRILE

Description:
1-Benzyl-pyrrolidine-3-carbonitrile, with the CAS number 10603-52-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a benzyl group and a cyano group at the 3-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in organic synthesis. Additionally, the benzyl group enhances its lipophilicity, which can influence its bioavailability and pharmacokinetic properties. As with many organic compounds, safety precautions should be observed when handling 1-benzyl-pyrrolidine-3-carbonitrile, as it may pose health risks if ingested or inhaled. Proper storage conditions and protective equipment are recommended to ensure safe handling.
Formula:C12H14N2
InChI:InChI=1/C12H14N2/c13-8-12-6-7-14(10-12)9-11-4-2-1-3-5-11/h1-5,12H,6-7,9-10H2
InChI key:RYCQUUNQHVAFSM-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CCC(C#N)C1
Synonyms:
  • 1-Benzyl-3-Cyano-Pyrrolidine
  • 1-Benzylpyrrolidine-3-Carbonitrile
Found 5 products.