CAS 10604-21-4: 3-PHENYLCINNOLINE-4-CARBOXYLIC ACID
Description:3-Phenylcinnoline-4-carboxylic acid is an organic compound characterized by its unique structure, which includes a cinnoline ring fused with a phenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may show different reactivity patterns due to the electron-donating or withdrawing effects of the phenyl group. Overall, 3-phenylcinnoline-4-carboxylic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry, warranting further investigation into its properties and uses.
Formula:C15H10N2O2
InChI:InChI=1/C15H10N2O2/c18-15(19)13-11-8-4-5-9-12(11)16-17-14(13)10-6-2-1-3-7-10/h1-9H,(H,18,19)
- Synonyms:
- Buttpark 30\08-37
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Phenylcinnoline-4-carboxylic acid REF: 10-F017481CAS: 10604-21-4 | - - - | 107.00 € | Thu 27 Feb 25 |
![]() | 3-Phenylcinnoline-4-carboxylic acid REF: 54-OR25692CAS: 10604-21-4 | - - - | 93.00 €~326.00 € | Tue 04 Mar 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-Phenylcinnoline-4-carboxylic acid
Ref: 10-F017481
1g | 107.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-Phenylcinnoline-4-carboxylic acid
Ref: 54-OR25692
1g | 93.00 € | ||
5g | 326.00 € |