CAS 10604-21-4

3-PHENYLCINNOLINE-4-CARBOXYLIC ACID

Description:

3-Phenylcinnoline-4-carboxylic acid is an organic compound characterized by its unique structure, which includes a cinnoline ring fused with a phenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may show different reactivity patterns due to the electron-donating or withdrawing effects of the phenyl group. Overall, 3-phenylcinnoline-4-carboxylic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry, warranting further investigation into its properties and uses.

Formula: C₁₅H₁₀N₂O₂

InChI: InChI=1/C15H10N2O2/c18-15(19)13-11-8-4-5-9-12(11)16-17-14(13)10-6-2-1-3-7-10/h1-9H,(H,18,19)

SMILES: c1ccc(cc1)c1c(c2ccccc2nn1)C(=O)O

Synonyms:

• Buttpark 30\08-37

3-Phenylcinnoline-4-carboxylic acid

CAS: 10604-21-4

3-Phenylcinnoline-4-carboxylic acid

Formula: C₁₅H₁₀N₂O₂

Purity: ≥95%

Color and Shape: yellow to green or light brown Solid

Molecular weight: 250.2521

Ref: 54-OR25692

3-Phenylcinnoline-4-carboxylic acid

CAS: 10604-21-4

Formula: C₁₅H₁₀N₂O₂

Color and Shape: Solid

Molecular weight: 250.257

Ref: 10-F017481