CAS 106058-85-9
:3-ACETYL-1-(P-TOLYLSULFONYL)PYRROLE
Description:
3-Acetyl-1-(p-tolylsulfonyl)pyrrole is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of an acetyl group at the 3-position and a p-tolylsulfonyl group at the 1-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its polar functional groups, while its aromatic nature may enhance stability and reactivity. The sulfonyl group can participate in various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may display biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its molecular structure allows for various substitution reactions, and it may undergo transformations such as nucleophilic attack or electrophilic substitution. Overall, 3-acetyl-1-(p-tolylsulfonyl)pyrrole is a versatile compound with potential utility in synthetic chemistry and medicinal applications.
Formula:C13H13NO3S
InChI:InChI=1/C13H13NO3S/c1-10-3-5-13(6-4-10)18(16,17)14-8-7-12(9-14)11(2)15/h3-9H,1-2H3
SMILES:Cc1ccc(cc1)S(=O)(=O)n1ccc(c1)C(=O)C
Synonyms:- 3-Acetyl-1-Tosylpyrrole
- 3-Acetyl-N-Tosylpyrrole
- 1-Tosyl-3-Acetylpyrrole
- 1-{1-[(4-methylphenyl)sulfonyl]-1H-pyrrol-3-yl}ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Acetyl-1-(p-tolylsulfonyl)pyrrole
CAS:Formula:C13H13NO3SPurity:97%Color and Shape:SolidMolecular weight:263.31223-Acetyl-1-tosylpyrrole
CAS:3-Acetyl-1-tosylpyrroleFormula:C13H13NO3SPurity:97%Molecular weight:263.312223-Acetyl-1-(p-tolylsulfonyl)pyrrole
CAS:Formula:C13H13NO3SPurity:97%Color and Shape:Solid, No data available.Molecular weight:263.313-Acetyl-1-tosylpyrrole
CAS:3-Acetyl-1-tosylpyrrole is a lipid peroxidation inhibitor that acts as an electron donor to react with free radicals. It can be used in the synthesis of anilines, which are used for the manufacture of dyes and pharmaceuticals. 3-Acetyl-1-tosylpyrrole has also been shown to have antioxidant properties, inhibiting carrageenan induced paw oedema. The compound is synthesized by a Wittig reaction using 1,3-dibromoindole and ethyl acetate in the presence of hydrochloric acid.
Formula:C13H13NO3SPurity:Min. 95%Molecular weight:263.32 g/mol



