CymitQuimica logo

CAS 1060801-31-1

:

Ethanone, 1-(2-amino-3-pyridinyl)-2,2,2-trifluoro-

Description:
Ethanone, 1-(2-amino-3-pyridinyl)-2,2,2-trifluoro- is a chemical compound characterized by its unique structure, which includes a trifluoroacetyl group and a pyridine ring with an amino substituent. This compound is part of the broader class of trifluoromethyl ketones, known for their reactivity and potential applications in medicinal chemistry and agrochemicals. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it an interesting candidate for drug development. The amino group on the pyridine ring can participate in hydrogen bonding and may influence the compound's biological activity. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many fluorinated compounds, it may exhibit unique physical and chemical properties, such as increased volatility and altered solubility compared to non-fluorinated analogs. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C7H5F3N2O
InChI:InChI=1S/C7H5F3N2O/c8-7(9,10)5(13)4-2-1-3-12-6(4)11/h1-3H,(H2,11,12)
InChI key:InChIKey=LZRWPDVXZUPHRC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(N)N=CC=C1
Synonyms:
  • 1-(2-Aminopyridin-3-yl)-2,2,2-trifluoroethan-1-one
  • Ethanone, 1-(2-amino-3-pyridinyl)-2,2,2-trifluoro-
  • 1-(2-Amino-pyridin-3-yl)-2,2,2-trifluoro-ethanone
Found 4 products.