CAS 1060804-15-0

Formula: C6H3ClN2O2S

InChI: InChI=1S/C6H3ClN2O2S/c7-12(10,11)6-1-5(2-8)3-9-4-6/h1,3-4H

InChI key: RZNCBFTUKKMELY-UHFFFAOYSA-N

SMILES: C1=C(C=NC=C1S(=O)(=O)Cl)C#N

5-Cyanopyridine-3-sulfonyl chloride

CAS: 1060804-15-0

5-Cyanopyridine-3-sulfonyl chloride

Formula: C₆H₃ClN₂O₂S

Purity: 98%

Molecular weight: 202.62

Ref: 54-OR1032336

5-Cyanopyridine-3-sulfonyl chloride

CAS: 1060804-15-0

Purity: 98%

Ref: IN-DA00956L

5-CYANOPYRIDINE-3-SULFONYL CHLORIDE

CAS: 1060804-15-0

Purity: 98%

Molecular weight: 202.6100006

Ref: 10-F808397

5-Cyanopyridine-3-sulfonyl chloride

CAS: 1060804-15-0

5-Cyanopyridine-3-sulfonyl chloride is a chemical compound that is used as an intermediate in the synthesis of various organic compounds. The chemical structure of this compound consists of a sulfonyl chloride group and a cyano group, which are bonded to the same carbon atom. It has been reported to have been used as a reaction component in the synthesis of other chemicals and can be used as a building block for complex compounds with high purity. 5-Cyanopyridine-3-sulfonyl chloride is also a reagent that can be used in research and manufacturing processes.

Formula: C₆H₃ClN₂O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 202.62 g/mol

Ref: 3D-FC10589