
CAS 1060805-95-9
:4-Chloro-6-Methylnicotinic acid
Description:
4-Chloro-6-Methylnicotinic acid is a chemical compound that belongs to the class of pyridinecarboxylic acids. It features a chlorinated pyridine ring with a methyl group and a carboxylic acid functional group. The presence of the chlorine atom at the 4-position and the methyl group at the 6-position contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the carboxylic acid group. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in organic synthesis and medicinal chemistry. Additionally, derivatives of nicotinic acid are often studied for their biological activities, including potential roles in pharmacology. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c1-4-2-6(8)5(3-9-4)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:NPFSHIQNHIGKKL-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=N1)C(=O)O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-6-methylnicotinic acid
CAS:Formula:C7H6ClNO2Purity:98%Color and Shape:SolidMolecular weight:171.58104-Chloro-6-methylnicotinic acid
CAS:4-Chloro-6-methylnicotinic acidFormula:C7H6ClNO2Purity:98%Molecular weight:171.581044-Chloro-6-methylnicotinic acid
CAS:4-Chloro-6-methylnicotinic acidFormula:C7H6ClNO2Purity:98%Molecular weight:171.584-Chloro-6-methylnicotinic acid
CAS:Formula:C7H6ClNO2Purity:98%Color and Shape:SolidMolecular weight:171.584-Chloro-6-methylnicotinic acid
CAS:4-Chloro-6-methylnicotinic acid (4C6MNA) is a chemical substance that is used in the study of plant leaves and their permeability. This substance has been found to be an excellent indicator of chlorophyll content, as it stains leaf cells with a green color. 4C6MNA is taken up by healthy plant cells and mitochondria, where it binds to the chromophore molecule in the mitochondria. The binding of 4C6MNA to the chromophore molecule leads to the production of fluorescence, which can be detected via microscopy. This substance has been used for laser microbeam studies on natural leaves and tobacco plants.Formula:C7H6CINO2Purity:Min. 95%Molecular weight:275.04 g/mol




