CymitQuimica logo

CAS 1060809-37-1

:

1-(4-Fluoro-2-pyridinyl)ethanone

Description:
1-(4-Fluoro-2-pyridinyl)ethanone, with the CAS number 1060809-37-1, is an organic compound characterized by its pyridine ring and a ketone functional group. The presence of a fluorine atom at the para position of the pyridine ring influences its chemical reactivity and physical properties, such as polarity and solubility. This compound typically exhibits a moderate boiling point and melting point, common for small organic molecules. It is likely to be soluble in polar organic solvents due to the presence of the ketone group, which can engage in hydrogen bonding. The fluorine substituent can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and reductions, due to the electrophilic nature of the carbonyl group. Overall, 1-(4-Fluoro-2-pyridinyl)ethanone is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H6FNO
InChI:InChI=1S/C7H6FNO/c1-5(10)7-4-6(8)2-3-9-7/h2-4H,1H3
InChI key:InChIKey=BFJVGJGEHDBZKY-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(F)=CC=N1
Synonyms:
  • 1-(4-Fluoro-2-pyridinyl)ethanone
  • Ethanone, 1-(4-fluoro-2-pyridinyl)-
Found 3 products.