CymitQuimica logo

CAS 1060811-59-7

:

2-Bromopyridine-3-sulfonyl chloride

Description:
2-Bromopyridine-3-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a brominated pyridine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The bromine atom on the pyridine ring enhances the electrophilicity of the molecule, making it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. This compound is generally handled with care due to its potential to release toxic gases upon hydrolysis and its corrosive nature. It is soluble in organic solvents, which facilitates its use in chemical reactions. As with many sulfonyl chlorides, it is important to store it in a cool, dry place, away from moisture and incompatible substances to maintain its stability and reactivity.
Formula:C5H3BrClNO2S
InChI:InChI=1S/C5H3BrClNO2S/c6-5-4(11(7,9)10)2-1-3-8-5/h1-3H
InChI key:XJPBDTIFSUZVAK-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)Br)S(=O)(=O)Cl
Found 2 products.