
CAS 1060811-61-1
:2-Bromopyridine-4-sulfonyl chloride
Description:
2-Bromopyridine-4-sulfonyl chloride is an organic compound characterized by the presence of a bromine atom, a pyridine ring, and a sulfonyl chloride functional group. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. The bromine atom on the pyridine ring can also serve as a site for further functionalization, allowing for the introduction of additional substituents. 2-Bromopyridine-4-sulfonyl chloride is soluble in organic solvents, and its handling requires caution due to its potential to release hydrochloric acid upon hydrolysis. As with many sulfonyl chlorides, it is important to store this compound in a cool, dry place, away from moisture and reactive substances, to maintain its stability and reactivity.
Formula:C5H3BrClNO2S
InChI:InChI=1S/C5H3BrClNO2S/c6-5-3-4(1-2-8-5)11(7,9)10/h1-3H
InChI key:ISYAMOKUNSIOHJ-UHFFFAOYSA-N
SMILES:C1=CN=C(C=C1S(=O)(=O)Cl)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Bromo-pyridine-4-sulfonyl Chloride
CAS:Controlled ProductFormula:C5H3BrClNO2SColor and Shape:NeatMolecular weight:256.505
