CymitQuimica logo

CAS 1060811-62-2

:

4,6-dichloro-nicotinaldehyde

Description:
4,6-Dichloro-nicotinaldehyde is a chemical compound that belongs to the class of heterocyclic compounds, specifically a derivative of nicotinic acid. It features a pyridine ring with two chlorine substituents at the 4 and 6 positions, along with an aldehyde functional group at the 2 position. This structure contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of chlorine atoms enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, the aldehyde group can participate in condensation reactions, further expanding its utility in synthetic pathways. The compound may exhibit biological activity, which could be of interest in pharmaceutical research. As with many chlorinated compounds, it is essential to handle 4,6-dichloro-nicotinaldehyde with care due to potential toxicity and environmental concerns. Overall, its distinctive structure and functional groups make it a valuable compound for research and development in various chemical fields.
Formula:C6H3Cl2NO
InChI:InChI=1S/C6H3Cl2NO/c7-5-1-6(8)9-2-4(5)3-10/h1-3H
InChI key:AKYJFAHYRMPRDS-UHFFFAOYSA-N
SMILES:C1=C(C(=CN=C1Cl)C=O)Cl
Synonyms:
  • 4,6-dichloro-3-Pyridinecarboxaldehyde
  • 4,6-Dichloropyridine-3-carboxaldehyde
Found 4 products.