CymitQuimica logo

CAS 106129-86-6

:

2-Propen-1-one, 3-(dimethylamino)-1-(2-hydroxyphenyl)-, (E)-

Description:
2-Propen-1-one, 3-(dimethylamino)-1-(2-hydroxyphenyl)-, (E)-, commonly known as a derivative of chalcone, is an organic compound characterized by its conjugated double bond system, which contributes to its reactivity and potential biological activity. This compound features a propenone structure with a dimethylamino group and a hydroxyphenyl substituent, indicating it may exhibit properties such as antioxidant activity and potential use in pharmaceuticals. The presence of the dimethylamino group enhances its solubility in polar solvents, while the hydroxyphenyl moiety can participate in hydrogen bonding, influencing its interaction with biological targets. The (E)- configuration denotes the specific geometric arrangement of substituents around the double bond, which can affect the compound's reactivity and biological interactions. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-12(2)8-7-11(14)9-5-3-4-6-10(9)13/h3-8,13H,1-2H3/b8-7+
InChI key:SVBCOAAIOJDZNC-BQYQJAHWSA-N
SMILES:CN(C)/C=C/C(=O)C1=CC=CC=C1O
Found 3 products.