CAS 106134-33-2
:N-(2,6-dimethylphenyl)-N-[3-(pyridin-3-yl)propyl]alaninamide dihydrochloride
Description:
N-(2,6-dimethylphenyl)-N-[3-(pyridin-3-yl)propyl]alaninamide dihydrochloride, with the CAS number 106134-33-2, is a synthetic compound characterized by its complex structure, which includes an alanine derivative linked to a pyridine moiety and a dimethylphenyl group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the amide functional group and the dihydrochloride salt form, which enhances its stability and solubility in aqueous environments. It may possess biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry. The presence of the pyridine ring suggests potential interactions with biological targets, while the dimethylphenyl group may influence its lipophilicity and overall pharmacokinetic profile. As with many compounds of this nature, its specific characteristics, including melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on the conditions of synthesis and formulation.
Formula:C19H27Cl2N3O
InChI:InChI=1/C19H25N3O.2ClH/c1-14-7-4-8-15(2)18(14)22(19(23)16(3)20)12-6-10-17-9-5-11-21-13-17;;/h4-5,7-9,11,13,16H,6,10,12,20H2,1-3H3;2*1H
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ro 22-9194
CAS:Ro 22-9194, a class I antiarrhythmic, reduces upstroke velocity and shortens action potential in guinea-pig hearts at ≥10 μM.Formula:C19H27Cl2N3OPurity:98%Color and Shape:SolidMolecular weight:384.35
