CymitQuimica logo

CAS 106148-96-3

:

Carbamic acid,[2-[3-hydroxy-4-(phenylmethoxy)phenyl]-2-oxoethyl]methyl-, phenylmethylester

Description:
Carbamic acid, specifically the compound with the name "Carbamic acid, [2-[3-hydroxy-4-(phenylmethoxy)phenyl]-2-oxoethyl]methyl-, phenylmethylester" and CAS number 106148-96-3, is an organic compound characterized by its carbamate functional group. This compound features a complex structure that includes a phenylmethoxy group, contributing to its potential as a pharmaceutical or agrochemical agent. The presence of hydroxyl and carbonyl groups indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The ester functionality suggests that it can undergo hydrolysis, which is a common reaction for carbamates. Additionally, the phenyl groups in its structure may enhance its lipophilicity, affecting its biological activity and interaction with various biological targets. Overall, this compound's unique structural features may provide specific properties that are valuable in medicinal chemistry, particularly in the development of drugs or other bioactive molecules. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C24H23NO5
InChI:InChI=1S/C24H23NO5/c1-25(24(28)30-17-19-10-6-3-7-11-19)15-22(27)20-12-13-23(21(26)14-20)29-16-18-8-4-2-5-9-18/h2-14,26H,15-17H2,1H3
InChI key:PUDLUGYWHPVFKP-UHFFFAOYSA-N
SMILES:CN(CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)O)C(=O)OCC3=CC=CC=C3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.