
CAS 1061650-42-7
:3-(2-Methoxyethyl)benzylaMine
Description:
3-(2-Methoxyethyl)benzylaMine is an organic compound characterized by its structure, which features a benzylamine core substituted with a 2-methoxyethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the methoxyethyl group enhances its hydrophilicity compared to simpler benzylamines, potentially affecting its reactivity and interactions in biological systems. The compound may also participate in nucleophilic reactions due to the amine functional group, making it of interest in synthetic organic chemistry. Additionally, its unique structure may confer specific pharmacological properties, making it a candidate for research in medicinal chemistry. Safety data and handling precautions should be considered, as with all chemical substances, due to potential toxicity or reactivity. Overall, 3-(2-Methoxyethyl)benzylaMine represents a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-12-6-5-9-3-2-4-10(7-9)8-11/h2-4,7H,5-6,8,11H2,1H3
InChI key:RBEPAYXEBWCUQK-UHFFFAOYSA-N
SMILES:COCCC1=CC(=CC=C1)CN
Synonyms:- 3-(2-Methoxyethyl)benzylaMine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
