CymitQuimica logo

CAS 1061650-69-8

:

(3-(cyclobutylmethoxy)phenyl)methanamine

Description:
The chemical substance known as (3-(cyclobutylmethoxy)phenyl)methanamine, with the CAS number 1061650-69-8, is an organic compound characterized by its phenyl ring substituted with a cyclobutylmethoxy group and an amine functional group. This compound features a methanamine moiety, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the cyclobutyl group may impart unique steric and electronic properties, influencing its reactivity and interaction with biological targets. Typically, such compounds can exhibit various biological activities, making them of interest in pharmaceutical research. The molecular structure suggests potential for hydrogen bonding due to the amine group, which can enhance solubility in polar solvents. Additionally, the methoxy group can affect the compound's lipophilicity and overall pharmacokinetic profile. Overall, (3-(cyclobutylmethoxy)phenyl)methanamine represents a class of compounds that may have applications in drug development and materials science, although specific biological activities and properties would require empirical investigation.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c13-8-11-5-2-6-12(7-11)14-9-10-3-1-4-10/h2,5-7,10H,1,3-4,8-9,13H2
InChI key:NRXZOCVWPLPAFC-UHFFFAOYSA-N
SMILES:C1CC(C1)COc1cccc(c1)CN
Synonyms:
  • 1-[3-(Cyclobutylmethoxy)phenyl]methanamine
Found 2 products.