CymitQuimica logo

CAS 106232-39-7

:

1H-Pyrazol-3-amine, 4-(methylsulfonyl)-, hydrochloride (1:1)

Description:
1H-Pyrazol-3-amine, 4-(methylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a methylsulfonyl group at the 4-position enhances its solubility and reactivity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit biological activity, potentially acting as a pharmacophore in drug development, particularly in areas such as anti-inflammatory or anti-cancer research. Its molecular properties, including solubility, melting point, and reactivity, can be influenced by the presence of the sulfonyl group and the hydrochloride form. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 1H-Pyrazol-3-amine, 4-(methylsulfonyl)-, hydrochloride is a compound of interest in various chemical and pharmaceutical applications.
Formula:C4H7N3O2S·ClH
InChI:InChI=1S/C4H7N3O2S.ClH/c1-10(8,9)3-2-6-7-4(3)5;/h2H,1H3,(H3,5,6,7);1H
InChI key:InChIKey=OAAXWOPCVWKMRC-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C(N)=NNC1.Cl
Synonyms:
  • 1H-Pyrazol-3-amine, 4-(methylsulfonyl)-, monohydrochloride
  • 1H-Pyrazol-3-amine, 4-(methylsulfonyl)-, hydrochloride (1:1)
Found 1 products.