CymitQuimica logo

CAS 106245-03-8

:

Ethanone, 1-[4-fluoro-2-(phenylmethoxy)phenyl]-

Description:
Ethanone, 1-[4-fluoro-2-(phenylmethoxy)phenyl]- is an organic compound characterized by its structure, which includes a ketone functional group and a substituted phenyl ring. The presence of a fluorine atom at the para position of the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and polarity. The phenylmethoxy group enhances the compound's lipophilicity, which may affect its solubility in organic solvents. This compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the fluorine substituent. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential biological activities, including anti-inflammatory or anticancer properties. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound represents a specific class of aromatic ketones with potential utility in various chemical and pharmaceutical applications.
Formula:C15H13FO2
InChI:InChI=1S/C15H13FO2/c1-11(17)14-8-7-13(16)9-15(14)18-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3
InChI key:VUAZCYADAXHDKI-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=C(C=C1)F)OCC2=CC=CC=C2
Synonyms:
  • 1-(2-(Benzyloxy)
  • 1-[4-Fluoro-2-(phenylmethoxy)phenyl]ethanone
  • 1-(2-(benzyloxy)-4-fluorophenyl)ethanone
Found 4 products.