CAS 106261-48-7
:4-(4-Methylpiperazin-1-ylmethyl)benzoic acid
Description:
4-(4-Methylpiperazin-1-ylmethyl)benzoic acid, with the CAS number 106261-48-7, is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with a 4-methylpiperazine group. This compound typically exhibits properties such as being a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols, owing to the presence of the carboxylic acid functional group. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display moderate to high lipophilicity due to the aromatic benzene ring, influencing its pharmacokinetic properties. Additionally, it may participate in hydrogen bonding due to the carboxylic acid, which can affect its interactions with biological targets. Overall, its unique structural features suggest potential applications in drug design and development, particularly in targeting central nervous system disorders or other therapeutic areas.
Formula:C13H18N2O2
InChI:InChI=1/C13H18N2O2/c1-14-6-8-15(9-7-14)10-11-2-4-12(5-3-11)13(16)17/h2-5H,6-10H2,1H3,(H,16,17)
SMILES:CN1CCN(CC1)Cc1ccc(cc1)C(=O)O
Synonyms:- 4-[(4-Methyl-1-piperaziny)methyl]benzoic acid
- 4-[4-Methyl-1-Piperazinylmethyl]Benzoic Acid
- 4-[(4-Methyl-1-piperazinyl)-methyl]-benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-Methylpiperazin-1-ylmethyl)benzoic acid
CAS:Formula:C13H18N2O2Purity:95%Color and Shape:SolidMolecular weight:234.2994-((4-Methylpiperazin-1-yl)methyl)benzoic acid
CAS:Formula:C13H18N2O2Purity:95%Color and Shape:SolidMolecular weight:234.29424-((4-Methylpiperazin-1-yl)methyl)benzoic acid
CAS:4-((4-Methylpiperazin-1-yl)methyl)benzoic acidFormula:C13H18N2O2Purity:95%Molecular weight:234.299Imatinib Impurity 20
CAS:Formula:C13H18N2O2Color and Shape:White To Off-White SolidMolecular weight:234.304-(4-Methylpiperazin-1-ylmethyl)benzoic Acid
CAS:Controlled ProductApplications 4-(4-Methylpiperazin-1-ylmethyl)Benzoic Acid (cas# 106261-48-7) is a useful research chemical.
Formula:C13H18N2O2Color and Shape:NeatMolecular weight:234.2944-[(4-Methylpiperazin-1-yl)methyl]benzoic acid
CAS:4-[(4-Methylpiperazin-1-yl)methyl]benzoic acid is an organic compound. It is a white solid that is insoluble in water but soluble in organic solvents. The molecule has a molecular weight of 224.8 g/mol and contains a carbonyl group and amine functional groups. 4-[(4-Methylpiperazin-1-yl)methyl]benzoic acid can be prepared by the acylation of 4-(aminomethyl)-benzoic acid with imidazole hydrochloride in the presence of sodium carbonate as a base.Formula:C13H18N2O2Purity:Min. 95%Molecular weight:234.29 g/mol





