CymitQuimica logo

CAS 106316-02-3

:

4-(Decyloxy)-2-fluorobenzoic acid

Description:
4-(Decyloxy)-2-fluorobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a decyloxy group and a fluorine atom. The presence of the decyloxy group, a long-chain alkoxy substituent, imparts hydrophobic characteristics, making the compound more lipophilic. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions with biological systems. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to the hydrophobic decyloxy chain. Its functional groups suggest potential applications in materials science, pharmaceuticals, or as a surfactant. Additionally, the presence of the carboxylic acid group allows for potential hydrogen bonding and reactivity in various chemical reactions. Overall, 4-(Decyloxy)-2-fluorobenzoic acid is a versatile compound with properties that can be tailored for specific applications in chemical synthesis and formulation.
Formula:C17H25FO3
InChI:InChI=1S/C17H25FO3/c1-2-3-4-5-6-7-8-9-12-21-14-10-11-15(17(19)20)16(18)13-14/h10-11,13H,2-9,12H2,1H3,(H,19,20)
InChI key:InChIKey=KGDJHFSYERDQGZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=C(OCCCCCCCCCC)C=C1
Synonyms:
  • 4-(Decyloxy)-2-fluorobenzoic acid
  • Benzoic acid, 4-(decyloxy)-2-fluoro-
Found 2 products.