CymitQuimica logo

CAS 106359-70-0

:

4-(Naphthalen-2-yl)benzoic acid

Description:
4-(Naphthalen-2-yl)benzoic acid, also known by its CAS number 106359-70-0, is an organic compound characterized by its aromatic structure, which consists of a naphthalene ring substituted with a benzoic acid moiety. This compound typically exhibits a high melting point and is relatively insoluble in water, but soluble in organic solvents such as ethanol and acetone. Its molecular structure contributes to its potential applications in various fields, including materials science and organic synthesis. The presence of both naphthalene and benzoic acid functional groups suggests that it may exhibit interesting properties such as fluorescence and potential use as a building block in the synthesis of more complex organic molecules. Additionally, its ability to form hydrogen bonds due to the carboxylic acid group may influence its reactivity and interactions in different chemical environments. Overall, 4-(Naphthalen-2-yl)benzoic acid is a compound of interest for researchers exploring aromatic compounds and their derivatives.
Formula:C17H12O2
InChI:InChI=1S/C17H12O2/c18-17(19)14-8-5-13(6-9-14)16-10-7-12-3-1-2-4-15(12)11-16/h1-11H,(H,18,19)
InChI key:KICDLSXFZOBMEW-UHFFFAOYSA-N
SMILES:C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C(=O)O
Found 3 products.