CymitQuimica logo

CAS 106418-67-1

:

1-Bromo-4-Decylbenzene

Description:
1-Bromo-4-decylbenzene is an organic compound characterized by a bromine atom attached to a benzene ring that also features a decyl (ten-carbon) alkyl chain at the para position. This structure imparts both hydrophobic and lipophilic properties, making it useful in various applications, including as a surfactant or in organic synthesis. The presence of the bromine atom enhances its reactivity, allowing for further chemical modifications. Typically, this compound is a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure contributes to its relatively low solubility in water while being soluble in organic solvents. The compound's physical and chemical properties, such as boiling point, melting point, and density, can vary based on the specific conditions and purity. Safety considerations are important when handling 1-bromo-4-decylbenzene, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken to minimize exposure.
Formula:C16H25Br
InChI:InChI=1/C16H25Br/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14H,2-10H2,1H3
InChI key:SWTGVSCSSDYINB-UHFFFAOYSA-N
SMILES:CCCCCCCCCCc1ccc(cc1)Br
Synonyms:
  • 4-Decylbromobenzene
  • 4-N-Decylbromobenzene
  • 1-Bromo-4-N-Decylbenzene
Found 5 products.