CymitQuimica logo

CAS 106423-29-4

:

2-Butene-1,4-bis(triphenylphosphonium chloride)

Description:
2-Butene-1,4-bis(triphenylphosphonium chloride) is a quaternary ammonium salt characterized by its unique structure, which features a butene backbone with two triphenylphosphonium groups attached at the 1 and 4 positions. This compound is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the triphenylphosphonium moieties enhances its reactivity, particularly in organic synthesis, where it can participate in various nucleophilic substitution reactions. The chloride ions associated with the phosphonium groups contribute to its ionic nature, making it a good candidate for applications in catalysis and as a reagent in organic transformations. Additionally, the compound's stability under standard conditions allows for its use in various chemical processes. Its unique properties make it valuable in synthetic organic chemistry, particularly in the formation of carbon-carbon bonds and in the synthesis of complex organic molecules. Safety precautions should be observed when handling this compound, as with many phosphonium salts, due to potential toxicity and reactivity.
Formula:C40H36Cl2P2
InChI:InChI=1/C40H36P2.2ClH/c1-7-21-35(22-8-1)41(36-23-9-2-10-24-36,37-25-11-3-12-26-37)33-19-20-34-42(38-27-13-4-14-28-38,39-29-15-5-16-30-39)40-31-17-6-18-32-40;;/h1-32H,33-34H2;2*1H/q+2;;/p-2/b20-19+;;
InChI key:OOACLPDZHDFCQP-UHFFFAOYSA-L
SMILES:C1=CC=C(C=C1)[P+](CC=CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.[Cl-].[Cl-]
Synonyms:
  • 1,4-Bis(triphenylphosphonium chloride)butene-2
  • (2E)-but-2-ene-1,4-diylbis(triphenylphosphonium) dichloride
Found 4 products.