CymitQuimica logo

CAS 106426-63-5

:

1,2,4,5-benzene-D2-tetracarboxylic dianhydride

Description:
1,2,4,5-Benzene-D2-tetracarboxylic dianhydride, with the CAS number 106426-63-5, is a chemical compound characterized by its structure, which includes a benzene ring substituted with four carboxylic acid groups that have been converted into anhydride forms. This compound is notable for its high thermal stability and reactivity, making it useful in various applications, particularly in the synthesis of polymers and as a building block in organic chemistry. The presence of deuterium (D2) indicates that the compound has been isotopically labeled, which can be advantageous in studies involving nuclear magnetic resonance (NMR) spectroscopy or in tracing chemical pathways. Its anhydride form allows it to readily react with nucleophiles, facilitating the formation of polyesters or other derivatives. Additionally, the compound's properties may include solubility in organic solvents and the ability to undergo further chemical transformations, making it a versatile intermediate in synthetic organic chemistry.
Formula:C10D2O6
InChI:InChI=1/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H/i1D,2D
SMILES:c1(c2c(c(c3c1c(=O)oc3=O)[2H])c(=O)oc2=O)[2H]
Synonyms:
  • (2H2)-1H,3H-benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone
Found 2 products.