CymitQuimica logo

CAS 106429-07-6

:

6-Benzothiazolemethanol,2-amino-(9CI)

Description:
6-Benzothiazolemethanol, 2-amino- (9CI) is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a hydroxymethyl group and an amino group, contributing to its potential reactivity and solubility in various solvents. It is typically a white to off-white solid, and its molecular structure allows for hydrogen bonding, which can influence its physical properties and interactions with other molecules. The presence of the amino group suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 106429-07-6, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and regulatory databases. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C8H8N2OS
InChI:InChI=1S/C8H8N2OS/c9-8-10-6-2-1-5(4-11)3-7(6)12-8/h1-3,11H,4H2,(H2,9,10)
InChI key:LPMULTSCZSOABY-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1CO)SC(=N2)N
Found 4 products.