CymitQuimica logo

CAS 106429-08-7

:

6-Benzothiazolecarboxaldehyde,2-amino-(9CI)

Description:
6-Benzothiazolecarboxaldehyde, 2-amino- (9CI), with the CAS number 106429-08-7, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an aldehyde functional group (-CHO) and an amino group (-NH2) attached to the benzothiazole framework, contributing to its reactivity and potential applications in various chemical reactions. It is typically a crystalline solid and may exhibit properties such as solubility in polar organic solvents. The presence of both the aldehyde and amino groups allows for versatile reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, compounds with similar structures are often studied for their biological activities, including antimicrobial and anticancer properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H6N2OS
InChI:InChI=1S/C8H6N2OS/c9-8-10-6-2-1-5(4-11)3-7(6)12-8/h1-4H,(H2,9,10)
InChI key:DCNYZCPMDDDDLR-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C=O)SC(=N2)N
Found 3 products.