CymitQuimica logo

CAS 1064666-48-3

:

1,3,2-Dioxathiolane, 4-(trifluoromethyl)-, 2,2-dioxide

Description:
1,3,2-Dioxathiolane, 4-(trifluoromethyl)-, 2,2-dioxide, identified by CAS number 1064666-48-3, is a heterocyclic organic compound characterized by its unique dioxathiolane ring structure. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The presence of the dioxathiolane moiety suggests that it may exhibit interesting chemical behavior, particularly in reactions involving nucleophiles or electrophiles. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its applications may span various fields, including pharmaceuticals, agrochemicals, or materials science, where its unique structural features can be exploited. Additionally, the trifluoromethyl group can enhance biological activity or stability, making it a valuable component in drug design. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with fluorinated compounds. Overall, 1,3,2-Dioxathiolane, 4-(trifluoromethyl)-, 2,2-dioxide represents a compound of interest for further research and application development.
Formula:C3H3F3O4S
InChI:InChI=1S/C3H3F3O4S/c4-3(5,6)2-1-9-11(7,8)10-2/h2H,1H2
InChI key:YTHOQNZONIUFRX-UHFFFAOYSA-N
SMILES:C1C(OS(=O)(=O)O1)C(F)(F)F
Synonyms:
  • 1,3,2-Dioxathiolane, 4-(trifluoromethyl)-, 2,2-dioxide
  • 4-(trifluoromethyl)-1,3,2-dioxathiolane-2,2-dioxide
Found 3 products.