CymitQuimica logo

CAS 1065-05-0

:

2,2,4,4,6,6-hexakis(2,2,2-trifluoroethoxy)-1,3,5,2lambda~5~,4lambda~5~,6lambda~5~-triazatriphosphinine

Description:
2,2,4,4,6,6-Hexakis(2,2,2-trifluoroethoxy)-1,3,5,2λ^5,4λ^5,6λ^5-triazatriphosphinine is a complex organophosphorus compound characterized by its unique structure, which includes a triazatriphosphinine core and multiple trifluoroethoxy substituents. This compound is notable for its high fluorine content, which imparts distinctive chemical properties such as increased hydrophobicity and thermal stability. The presence of trifluoroethoxy groups enhances its solubility in organic solvents while potentially affecting its reactivity and interaction with other chemical species. The triazatriphosphinine framework contributes to its potential applications in materials science, particularly in the development of flame retardants or as a precursor for advanced phosphorous-containing materials. Additionally, the compound's unique electronic properties may make it of interest in the field of coordination chemistry and catalysis. However, due to its complexity, detailed studies on its reactivity, stability, and potential applications are essential for fully understanding its behavior in various chemical environments.
Formula:C12H12F18N3O6P3
InChI:InChI=1/C12H12F18N3O6P3/c13-7(14,15)1-34-40(35-2-8(16,17)18)31-41(36-3-9(19,20)21,37-4-10(22,23)24)33-42(32-40,38-5-11(25,26)27)39-6-12(28,29)30/h1-6H2
SMILES:C(C(F)(F)F)OP1(=NP(=NP(=N1)(OCC(F)(F)F)OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F)OCC(F)(F)F
Found 2 products.