CymitQuimica logo

CAS 1065073-46-2

:

N,2-Dimethyl-4-oxazolemethanamine

Description:
N,2-Dimethyl-4-oxazolemethanamine is a chemical compound characterized by its oxazole ring, which contributes to its heterocyclic structure. This compound features a dimethyl substitution at the nitrogen atom and an amine functional group, which can influence its reactivity and solubility. Typically, compounds with oxazole rings exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the amine group suggests potential for hydrogen bonding, which can affect its interactions with other molecules. Additionally, the dimethyl groups may enhance lipophilicity, impacting its pharmacokinetic properties. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Overall, N,2-Dimethyl-4-oxazolemethanamine represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c1-5-8-6(3-7-2)4-9-5/h4,7H,3H2,1-2H3
InChI key:InChIKey=SFLPQWGHHRKLNJ-UHFFFAOYSA-N
SMILES:C(NC)C=1N=C(C)OC1
Synonyms:
  • N-Methyl-1-(2-methyloxazol-4-yl)methanamine
  • 4-Oxazolemethanamine, N,2-dimethyl-
  • N,2-Dimethyl-4-oxazolemethanamine
Found 1 products.