CymitQuimica logo

CAS 1065074-12-5

:

4-Bromo-3-methoxy-N,N-dimethylbenzamide

Description:
4-Bromo-3-methoxy-N,N-dimethylbenzamide is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzamide framework. The presence of the bromine atom introduces notable electrophilic properties, while the methoxy group can influence the compound's reactivity and solubility due to its electron-donating characteristics. The N,N-dimethyl substitution on the amide nitrogen enhances the compound's lipophilicity, potentially affecting its biological activity and interaction with various receptors or enzymes. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring modulation of biological pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of substituents on the benzene ring, which can be critical for its function in various chemical and biological contexts. Overall, 4-Bromo-3-methoxy-N,N-dimethylbenzamide represents a unique chemical entity with diverse potential applications.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-12(2)10(13)7-4-5-8(11)9(6-7)14-3/h4-6H,1-3H3
InChI key:InChIKey=RIDSVLNSIKUVKR-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=CC(OC)=C(Br)C=C1
Synonyms:
  • 4-Bromo-3-methoxy-N,N-dimethylbenzamide
  • Benzamide, 4-bromo-3-methoxy-N,N-dimethyl-
Found 4 products.