CymitQuimica logo

CAS 1065074-97-6

:

Ethyl 3-bromo-6-chloro-2-pyridinecarboxylate

Description:
Ethyl 3-bromo-6-chloro-2-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features both bromine and chlorine substituents, which contribute to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of halogens (bromine and chlorine) can also influence the compound's biological activity, potentially making it a candidate for pharmaceutical development. Additionally, the compound's structure suggests it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens and the carboxylate group. Overall, Ethyl 3-bromo-6-chloro-2-pyridinecarboxylate is a versatile intermediate in organic chemistry, with potential applications in drug discovery and material science.
Formula:C8H7BrClNO2
InChI:InChI=1S/C8H7BrClNO2/c1-2-13-8(12)7-5(9)3-4-6(10)11-7/h3-4H,2H2,1H3
InChI key:InChIKey=UWVRCYTYBWYKNZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Br)C=CC(Cl)=N1
Synonyms:
  • Ethyl 3-bromo-6-chloro-2-pyridinecarboxylate
  • 2-Pyridinecarboxylic acid, 3-bromo-6-chloro-, ethyl ester
Found 5 products.