CymitQuimica logo

CAS 1065092-39-8

:

5-Bromo-8-fluoro-4-quinolinol

Description:
5-Bromo-8-fluoro-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and fluorine substituents at the 5 and 8 positions, respectively, contributes to its unique chemical properties and potential biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for halogenated quinoline derivatives. Its functional groups can participate in various chemical reactions, making it a candidate for applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit antimicrobial or antitumor properties, although specific biological activities would require further investigation. Additionally, the presence of halogens can influence the compound's reactivity and stability, affecting its behavior in different chemical environments. Overall, 5-Bromo-8-fluoro-4-quinolinol represents a class of compounds with significant potential for research and application in various fields of chemistry and pharmacology.
Formula:C9H5BrFNO
InChI:InChI=1S/C9H5BrFNO/c10-5-1-2-6(11)9-8(5)7(13)3-4-12-9/h1-4H,(H,12,13)
InChI key:InChIKey=GZLLDRWYEUNPGR-UHFFFAOYSA-N
SMILES:FC=1C2=C(C(Br)=CC1)C(O)=CC=N2
Synonyms:
  • 5-Bromo-8-fluoro-4-quinolinol
  • 4-Quinolinol, 5-bromo-8-fluoro-
Found 1 products.