CymitQuimica logo

CAS 1065124-65-3

:

[2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-[(1Z)-2-cyano-1-propen-1-yl]-2,2-dimethylcyclopropanecarboxylate

Description:
The chemical substance known as [2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-[(1Z)-2-cyano-1-propen-1-yl]-2,2-dimethylcyclopropanecarboxylate, with the CAS number 1065124-65-3, is a complex organic compound characterized by its unique structural features. It contains a tetrafluorinated phenyl group, which enhances its reactivity and stability due to the electronegative fluorine atoms. The presence of a methoxymethyl substituent contributes to its solubility and potential interactions in various chemical environments. The cyclopropanecarboxylate moiety indicates potential applications in synthetic chemistry, particularly in the development of pharmaceuticals or agrochemicals. The (1R,3R) stereochemistry suggests specific spatial arrangements that may influence its biological activity and interactions with other molecules. Additionally, the cyano and propenyl groups introduce functional diversity, allowing for potential reactivity in further chemical transformations. Overall, this compound's intricate structure and functional groups suggest it may have significant applications in medicinal chemistry and materials science.
Formula:C19H19F4NO3
InChI:InChI=1S/C19H19F4NO3/c1-9(6-24)5-12-13(19(12,2)3)18(25)27-8-11-16(22)14(20)10(7-26-4)15(21)17(11)23/h5,12-13H,7-8H2,1-4H3/b9-5-/t12-,13+/m1/s1
InChI key:InChIKey=DPJITPZADZSLBP-DQXQJKBJSA-N
SMILES:C(=C(\C#N)/C)\[C@@H]1[C@@H](C(OCC2=C(F)C(F)=C(COC)C(F)=C2F)=O)C1(C)C
Synonyms:
  • Cyclopropanecarboxylic acid, 3-[(1Z)-2-cyano-1-propen-1-yl]-2,2-dimethyl-, [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl ester, (1R,3R)-
  • Epsilon-momfluorothrin
  • [2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-[(1Z)-2-cyano-1-propen-1-yl]-2,2-dimethylcyclopropanecarboxylate
Found 5 products.