CymitQuimica logo

CAS 106516-07-8

:

1H-Indole, 5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydro-4-pyridinyl)-

Description:
1H-Indole, 5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydro-4-pyridinyl)-, with CAS number 106516-07-8, is a chemical compound that belongs to the indole class of heterocyclic compounds. It features a fused bicyclic structure consisting of a benzene ring and a pyrrole ring, which is characteristic of indoles. The presence of a chlorine atom at the 5-position and a fluorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. Additionally, the compound contains a tetrahydropyridine moiety, which may influence its pharmacological properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as indole derivatives are known for various biological activities, including anti-inflammatory and anticancer properties. Its molecular structure suggests that it may interact with biological targets, making it a candidate for further research in therapeutic applications. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C19H16ClFN2
InChI:InChI=1S/C19H16ClFN2/c20-14-1-6-19-17(11-14)18(13-7-9-22-10-8-13)12-23(19)16-4-2-15(21)3-5-16/h1-7,11-12,22H,8-10H2
InChI key:WLQZFXJVVNNEJU-UHFFFAOYSA-N
SMILES:C1CNCC=C1C2=CN(C3=C2C=C(C=C3)Cl)C4=CC=C(C=C4)F
Found 1 products.