CymitQuimica logo

CAS 1065483-60-4

:

2-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-imidazole

Description:
2-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 2-position of the imidazole ring introduces a halogen substituent, which can influence the compound's reactivity and potential applications in organic synthesis. The tetrahydro-2H-pyran moiety attached to the imidazole provides a cyclic ether structure that can enhance the compound's solubility and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. The specific interactions and reactivity of this compound can be further explored through synthetic chemistry and biological assays, contributing to the understanding of its properties and potential uses. As with any chemical substance, safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c9-8-10-4-5-11(8)7-3-1-2-6-12-7/h4-5,7H,1-3,6H2
InChI key:InChIKey=YYBSLCMICUQPIA-UHFFFAOYSA-N
SMILES:BrC=1N(C=CN1)C2CCCCO2
Synonyms:
  • 2-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-imidazole
  • 1H-Imidazole, 2-bromo-1-(tetrahydro-2H-pyran-2-yl)-
  • 2-Bromo-1-(oxan-2-yl)-1H-imidazole
  • 2-Bromo-1-(oxan-2-yl)imidazole
Found 5 products.