CymitQuimica logo

CAS 106556-66-5

:

2,2-Dimethyl-3-oxo-pyrrolidine-1-carboxylic acid ethyl ester

Description:
2,2-Dimethyl-3-oxo-pyrrolidine-1-carboxylic acid ethyl ester, identified by its CAS number 106556-66-5, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid moiety that is esterified with an ethyl group, contributing to its solubility and reactivity. The presence of two methyl groups at the 2-position and a keto group at the 3-position enhances its steric and electronic properties, making it a potential candidate for various synthetic applications. Typically, compounds of this nature may exhibit biological activity, and their derivatives are often explored in medicinal chemistry for potential therapeutic uses. Additionally, the compound's stability, reactivity, and interaction with other chemical species can be influenced by the functional groups present, making it a subject of interest in organic synthesis and pharmaceutical development. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H15NO3
InChI:InChI=1/C9H15NO3/c1-4-13-8(12)10-6-5-7(11)9(10,2)3/h4-6H2,1-3H3
InChI key:HWPDAUHYYHRPNF-UHFFFAOYSA-N
SMILES:CCOC(=O)N1CCC(=O)C1(C)C
Synonyms:
  • 1-Pyrrolidinecarboxylic Acid, 2,2-Dimethyl-3-Oxo-, Ethyl Ester
  • Ethyl 2,2-dimethyl-3-oxo-1-pyrrolidinecarboxylate
  • Ethyl 2,2-dimethyl-3-oxopyrrolidine-1-carboxylate
Found 4 products.