CAS 106561-29-9

Furo[2,3-d]pyrimidin-4(1H)-one, 5,6-diphenyl-

Description:

Furo[2,3-d]pyrimidin-4(1H)-one, 5,6-diphenyl- is a heterocyclic organic compound characterized by its fused furan and pyrimidine rings. This compound features a pyrimidinone structure, which includes a carbonyl group at the 4-position, contributing to its reactivity and potential biological activity. The presence of two phenyl groups at the 5 and 6 positions enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The compound is typically synthesized through multi-step organic reactions, often involving cyclization processes. Its unique structure may confer interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, the compound's CAS number, 106561-29-9, allows for easy identification and reference in chemical databases. Overall, Furo[2,3-d]pyrimidin-4(1H)-one, 5,6-diphenyl- represents a class of compounds that may exhibit diverse applications in drug development and other fields of chemistry.

Formula: C₁₈H₁₂N₂O₂

InChI: InChI=1S/C18H12N2O2/c21-17-15-14(12-7-3-1-4-8-12)16(13-9-5-2-6-10-13)22-18(15)20-11-19-17/h1-11H,(H,19,20,21)

InChI key: PEFVPWSISZURQJ-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=C(OC3=C2C(=O)NC=N3)C4=CC=CC=C4

5,6-Diphenylfuro[2,3-d]pyrimidin-4-ol

CAS: 106561-29-9

Formula: C₁₈H₁₂N₂O₂

Molecular weight: 288.3001

Ref: IN-DA008TG9