CymitQuimica logo

CAS 1065663-52-6

:

Boronic acid, B-[1,1':3',1''-terphenyl]-2'-yl-

Description:
Boronic acid, B-[1,1':3',1''-terphenyl]-2'-yl- (CAS 1065663-52-6) is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a terphenyl structure. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The terphenyl moiety contributes to its stability and can influence its electronic properties, potentially enhancing its reactivity in cross-coupling reactions. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic chemistry. Additionally, the compound may exhibit unique solubility characteristics and reactivity profiles due to the steric and electronic effects of the terphenyl substituent. Overall, this compound is of interest in both academic research and industrial applications, particularly in the development of pharmaceuticals and advanced materials.
Formula:C18H15BO2
InChI:InChI=1S/C18H15BO2/c20-19(21)18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13,20-21H
InChI key:LHZVACLBKORXAF-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC=C1C2=CC=CC=C2)C3=CC=CC=C3)(O)O
Synonyms:
  • Boronic acid, B-[1,1':3',1''-terphenyl]-2'-yl-
  • 1,1':3',1''-Terphenyl]-2'-ylboronic acid
Found 4 products.